Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Barium Chloride, Anhydrous, Thermo Scientific Chemicals
CAS: 10361-37-2 Molecular Formula: BaCl2 Molecular Weight (g/mol): 208.23 MDL Number: MFCD00003445 InChI Key: WDIHJSXYQDMJHN-UHFFFAOYSA-L Synonym: barium chloride,barium dichloride,barium chloride solution,ccris 2286,barium chloride, anhydrous,barium chloride, ultra dry,bariumchlorid,dichlorobarium,dsstox_cid_24508 PubChem CID: 25204 ChEBI: CHEBI:63317 IUPAC Name: barium(2+) dichloride SMILES: [Cl-].[Cl-].[Ba++]
| PubChem CID | 25204 |
|---|---|
| CAS | 10361-37-2 |
| Molecular Weight (g/mol) | 208.23 |
| ChEBI | CHEBI:63317 |
| MDL Number | MFCD00003445 |
| SMILES | [Cl-].[Cl-].[Ba++] |
| Synonym | barium chloride,barium dichloride,barium chloride solution,ccris 2286,barium chloride, anhydrous,barium chloride, ultra dry,bariumchlorid,dichlorobarium,dsstox_cid_24508 |
| IUPAC Name | barium(2+) dichloride |
| InChI Key | WDIHJSXYQDMJHN-UHFFFAOYSA-L |
| Molecular Formula | BaCl2 |
Ammonium hexachlororuthenate(IV), 99.99%, (trace metal basis)
CAS: 18746-63-9 Molecular Formula: Cl6H8N2Ru Molecular Weight (g/mol): 349.85 MDL Number: MFCD00015962 InChI Key: DHTSBQSPUBOKKI-UHFFFAOYSA-J Synonym: ammonium hexachlororuthenate iv,diammonium hexachlororuthenate,ammonium chlororuthenate,ammonium hexachlororuthenate,epitope id:151520,ruthenium iv-ammonium chloride,ammonium hexachloridoruthenate iv,ammonium hexachloridoruthenate 2-,diammonium hexachlororuthenate 2- PubChem CID: 46173598 ChEBI: CHEBI:60134 IUPAC Name: diazanium;hexachlororuthenium(2-) SMILES: [NH4+].[NH4+].[Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Ru+4]
| PubChem CID | 46173598 |
|---|---|
| CAS | 18746-63-9 |
| Molecular Weight (g/mol) | 349.85 |
| ChEBI | CHEBI:60134 |
| MDL Number | MFCD00015962 |
| SMILES | [NH4+].[NH4+].[Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Ru+4] |
| Synonym | ammonium hexachlororuthenate iv,diammonium hexachlororuthenate,ammonium chlororuthenate,ammonium hexachlororuthenate,epitope id:151520,ruthenium iv-ammonium chloride,ammonium hexachloridoruthenate iv,ammonium hexachloridoruthenate 2-,diammonium hexachlororuthenate 2- |
| IUPAC Name | diazanium;hexachlororuthenium(2-) |
| InChI Key | DHTSBQSPUBOKKI-UHFFFAOYSA-J |
| Molecular Formula | Cl6H8N2Ru |
Lead(II) perchlorate trihydrate, ACS, 97.0-102.0%
CAS: 13453-62-8 Molecular Formula: Cl2H6O11Pb Molecular Weight (g/mol): 460.10 MDL Number: MFCD00149817 InChI Key: KKGGEAQRICYXNM-UHFFFAOYSA-L Synonym: lead ii perchlorate trihydrate,acmc-20aknd,2clo4.pb.3h2o,lead perchlorate 3h2o,lead ii perchlorate, trihydrate,lead perchlorate, trihydrate, reagent acs,lead ii perchlorate trihydrate, acs reagent PubChem CID: 25021834 IUPAC Name: lead(2+);diperchlorate;trihydrate SMILES: O.O.O.[Pb++].[O-][Cl](=O)(=O)=O.[O-][Cl](=O)(=O)=O
| PubChem CID | 25021834 |
|---|---|
| CAS | 13453-62-8 |
| Molecular Weight (g/mol) | 460.10 |
| MDL Number | MFCD00149817 |
| SMILES | O.O.O.[Pb++].[O-][Cl](=O)(=O)=O.[O-][Cl](=O)(=O)=O |
| Synonym | lead ii perchlorate trihydrate,acmc-20aknd,2clo4.pb.3h2o,lead perchlorate 3h2o,lead ii perchlorate, trihydrate,lead perchlorate, trihydrate, reagent acs,lead ii perchlorate trihydrate, acs reagent |
| IUPAC Name | lead(2+);diperchlorate;trihydrate |
| InChI Key | KKGGEAQRICYXNM-UHFFFAOYSA-L |
| Molecular Formula | Cl2H6O11Pb |
Molybdenum foil, 0.25mm (0.01in) thick, annealed, 99.95% (metals basis)
CAS: 7439-98-7 Molecular Formula: Mo Molecular Weight (g/mol): 95.95 MDL Number: MFCD00003465 InChI Key: ZOKXTWBITQBERF-UHFFFAOYSA-N Synonym: molybdenum, elemental,6+ ion,mchvl,vi ion,molybdenum, metallic,metco 63,atom,molybdenum, ion 6+,tsm1,amperit 106.2 PubChem CID: 23932 ChEBI: CHEBI:28685 IUPAC Name: molybdenum SMILES: [Mo]
| PubChem CID | 23932 |
|---|---|
| CAS | 7439-98-7 |
| Molecular Weight (g/mol) | 95.95 |
| ChEBI | CHEBI:28685 |
| MDL Number | MFCD00003465 |
| SMILES | [Mo] |
| Synonym | molybdenum, elemental,6+ ion,mchvl,vi ion,molybdenum, metallic,metco 63,atom,molybdenum, ion 6+,tsm1,amperit 106.2 |
| IUPAC Name | molybdenum |
| InChI Key | ZOKXTWBITQBERF-UHFFFAOYSA-N |
| Molecular Formula | Mo |
Zinc Oxide, ACS,Reag. Ph Eur, For Analysis, EMSURE™, MilliporeSigma™
CAS: 1314-13-2 Molecular Formula: OZn Molecular Weight (g/mol): 81.38 MDL Number: MFCD00011300 InChI Key: XLOMVQKBTHCTTD-UHFFFAOYSA-N Synonym: zinc oxide,zinc white,amalox,permanent white,Chinese white,snow white,emanay zinc oxide,felling zinc oxide,zinc oxide zno,akro-zinc bar 85 PubChem CID: 14806 ChEBI: CHEBI:36560 IUPAC Name: oxozinc SMILES: O=[Zn]
| PubChem CID | 14806 |
|---|---|
| CAS | 1314-13-2 |
| Molecular Weight (g/mol) | 81.38 |
| ChEBI | CHEBI:36560 |
| MDL Number | MFCD00011300 |
| SMILES | O=[Zn] |
| Synonym | zinc oxide,zinc white,amalox,permanent white,Chinese white,snow white,emanay zinc oxide,felling zinc oxide,zinc oxide zno,akro-zinc bar 85 |
| IUPAC Name | oxozinc |
| InChI Key | XLOMVQKBTHCTTD-UHFFFAOYSA-N |
| Molecular Formula | OZn |
Barium Sulfate, Powder, BAKER ANALYZED™ Reagent, J.T. Baker™
CAS: 7727-43-7 Molecular Formula: BaO4S Molecular Weight (g/mol): 233.38 MDL Number: MFCD00003455 InChI Key: TZCXTZWJZNENPQ-UHFFFAOYSA-L Synonym: barium sulfate,barite,baritop,barosperse,barotrast,esophotrast,liquipake,macropaque,micropaque,microtrast PubChem CID: 24414 SMILES: [Ba++].[O-]S([O-])(=O)=O
| PubChem CID | 24414 |
|---|---|
| CAS | 7727-43-7 |
| Molecular Weight (g/mol) | 233.38 |
| MDL Number | MFCD00003455 |
| SMILES | [Ba++].[O-]S([O-])(=O)=O |
| Synonym | barium sulfate,barite,baritop,barosperse,barotrast,esophotrast,liquipake,macropaque,micropaque,microtrast |
| InChI Key | TZCXTZWJZNENPQ-UHFFFAOYSA-L |
| Molecular Formula | BaO4S |
Barium Sulfate, U.S.P., J.T. Baker™
CAS: 7727-43-7 Molecular Formula: BaO4S Molecular Weight (g/mol): 233.38 MDL Number: MFCD00003455 InChI Key: TZCXTZWJZNENPQ-UHFFFAOYSA-L Synonym: barium sulfate,barite,baritop,barosperse,barotrast,esophotrast,liquipake,macropaque,micropaque,microtrast PubChem CID: 24414 IUPAC Name: barium(2+);sulfate SMILES: [Ba++].[O-]S([O-])(=O)=O
| PubChem CID | 24414 |
|---|---|
| CAS | 7727-43-7 |
| Molecular Weight (g/mol) | 233.38 |
| MDL Number | MFCD00003455 |
| SMILES | [Ba++].[O-]S([O-])(=O)=O |
| Synonym | barium sulfate,barite,baritop,barosperse,barotrast,esophotrast,liquipake,macropaque,micropaque,microtrast |
| IUPAC Name | barium(2+);sulfate |
| InChI Key | TZCXTZWJZNENPQ-UHFFFAOYSA-L |
| Molecular Formula | BaO4S |
Cobalt, 99+%, Thermo Scientific Chemicals
CAS: 7440-48-4 Molecular Formula: Co Molecular Weight (g/mol): 58.93 MDL Number: MFCD00010935 InChI Key: GUTLYIVDDKVIGB-UHFFFAOYSA-N Synonym: kobalt,cobalto,moncation,co1+,cobaltum,powder,cobalt, ion co1+,hydrido,atom,hydride PubChem CID: 104730 ChEBI: CHEBI:27638 IUPAC Name: cobalt SMILES: [Co]
| PubChem CID | 104730 |
|---|---|
| CAS | 7440-48-4 |
| Molecular Weight (g/mol) | 58.93 |
| ChEBI | CHEBI:27638 |
| MDL Number | MFCD00010935 |
| SMILES | [Co] |
| Synonym | kobalt,cobalto,moncation,co1+,cobaltum,powder,cobalt, ion co1+,hydrido,atom,hydride |
| IUPAC Name | cobalt |
| InChI Key | GUTLYIVDDKVIGB-UHFFFAOYSA-N |
| Molecular Formula | Co |
tert-Butyldiphenylchlorosilane, 97%
CAS: 58479-61-1 Molecular Formula: C16H19ClSi Molecular Weight (g/mol): 274.863 MDL Number: MFCD00000497 InChI Key: MHYGQXWCZAYSLJ-UHFFFAOYSA-N Synonym: tert-butylchlorodiphenylsilane,tert-butyldiphenylchlorosilane,t-butyldiphenylchlorosilane,silane, chloro 1,1-dimethylethyl diphenyl,tert-butyl chloro diphenylsilane,t-butylchlorodiphenylsilane,tbdpscl,t-butyldiphenylsilyl chloride,tert-butyldiphenyl chlorosilane,unii-3beu48ui4e PubChem CID: 94078 IUPAC Name: tert-butyl-chloro-diphenylsilane SMILES: CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)Cl
| PubChem CID | 94078 |
|---|---|
| CAS | 58479-61-1 |
| Molecular Weight (g/mol) | 274.863 |
| MDL Number | MFCD00000497 |
| SMILES | CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)Cl |
| Synonym | tert-butylchlorodiphenylsilane,tert-butyldiphenylchlorosilane,t-butyldiphenylchlorosilane,silane, chloro 1,1-dimethylethyl diphenyl,tert-butyl chloro diphenylsilane,t-butylchlorodiphenylsilane,tbdpscl,t-butyldiphenylsilyl chloride,tert-butyldiphenyl chlorosilane,unii-3beu48ui4e |
| IUPAC Name | tert-butyl-chloro-diphenylsilane |
| InChI Key | MHYGQXWCZAYSLJ-UHFFFAOYSA-N |
| Molecular Formula | C16H19ClSi |
Rubidium sulfate, 99% (metals basis)
CAS: 7488-54-2 Molecular Formula: H2O4RbS Molecular Weight (g/mol): 183.54 MDL Number: MFCD00011190 InChI Key: XNNUAZGCOYTNQE-UHFFFAOYSA-N PubChem CID: 197088 IUPAC Name: sulfuric acid rubidium SMILES: [Rb].OS(O)(=O)=O
| PubChem CID | 197088 |
|---|---|
| CAS | 7488-54-2 |
| Molecular Weight (g/mol) | 183.54 |
| MDL Number | MFCD00011190 |
| SMILES | [Rb].OS(O)(=O)=O |
| IUPAC Name | sulfuric acid rubidium |
| InChI Key | XNNUAZGCOYTNQE-UHFFFAOYSA-N |
| Molecular Formula | H2O4RbS |
Platinum wire, 0.0508mm (0.002in) dia, 99.95% (metals basis)
CAS: 6-4-7440 Molecular Formula: Pt Molecular Weight (g/mol): 195.08 MDL Number: MFCD00011179 InChI Key: BASFCYQUMIYNBI-UHFFFAOYSA-N Synonym: black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion PubChem CID: 23939 ChEBI: CHEBI:33400 IUPAC Name: platinum SMILES: [Pt]
| PubChem CID | 23939 |
|---|---|
| CAS | 6-4-7440 |
| Molecular Weight (g/mol) | 195.08 |
| ChEBI | CHEBI:33400 |
| MDL Number | MFCD00011179 |
| SMILES | [Pt] |
| Synonym | black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion |
| IUPAC Name | platinum |
| InChI Key | BASFCYQUMIYNBI-UHFFFAOYSA-N |
| Molecular Formula | Pt |
Potassium tetrabromoaurate(III) dihydrate, Premion™, 99.99% (metals basis), Au 33% min
CAS: 13005-38-4 Molecular Formula: KAuBr4·2H2O MDL Number: MFCD00049650 Synonym: Gold potassium bromide
| CAS | 13005-38-4 |
|---|---|
| MDL Number | MFCD00049650 |
| Synonym | Gold potassium bromide |
| Molecular Formula | KAuBr4·2H2O |
Lithium hydroxide monohydrate, LiOH 56.5% min
CAS: 1310-66-3 Molecular Formula: H3LiO2 Molecular Weight (g/mol): 41.96 MDL Number: MFCD00149772 InChI Key: GLXDVVHUTZTUQK-UHFFFAOYSA-M Synonym: lithium hydroxide monohydrate,lithium hydroxide hydrate,lithium hydroxido,hydroxyde de lithium,unii-g51xlp968g,lithium hydroxide, monohydrate,lithiumhydrate,lioh-hydrate,lioh.hydrate,lioh water PubChem CID: 168937 SMILES: [Li+].O.[OH-]
| PubChem CID | 168937 |
|---|---|
| CAS | 1310-66-3 |
| Molecular Weight (g/mol) | 41.96 |
| MDL Number | MFCD00149772 |
| SMILES | [Li+].O.[OH-] |
| Synonym | lithium hydroxide monohydrate,lithium hydroxide hydrate,lithium hydroxido,hydroxyde de lithium,unii-g51xlp968g,lithium hydroxide, monohydrate,lithiumhydrate,lioh-hydrate,lioh.hydrate,lioh water |
| InChI Key | GLXDVVHUTZTUQK-UHFFFAOYSA-M |
| Molecular Formula | H3LiO2 |
Thallium rod, 12.7mm (0.5in) dia, 99.999% (metals basis)
CAS: 7440-28-0 Molecular Formula: Tl Molecular Weight (g/mol): 204.38 MDL Number: MFCD00134063 InChI Key: BKVIYDNLLOSFOA-UHFFFAOYSA-N Synonym: ramor,thallium, metallic,thallium, elemental,unii-ad84r52xlf,thallium, soluble compounds,ad84r52xlf,thallium, elemental and soluble compounds,rod, 12.7mm 0.5in dia,granules,thallium PubChem CID: 5359464 ChEBI: CHEBI:30440 IUPAC Name: thallium SMILES: [Tl]
| PubChem CID | 5359464 |
|---|---|
| CAS | 7440-28-0 |
| Molecular Weight (g/mol) | 204.38 |
| ChEBI | CHEBI:30440 |
| MDL Number | MFCD00134063 |
| SMILES | [Tl] |
| Synonym | ramor,thallium, metallic,thallium, elemental,unii-ad84r52xlf,thallium, soluble compounds,ad84r52xlf,thallium, elemental and soluble compounds,rod, 12.7mm 0.5in dia,granules,thallium |
| IUPAC Name | thallium |
| InChI Key | BKVIYDNLLOSFOA-UHFFFAOYSA-N |
| Molecular Formula | Tl |
Lithium phosphate, Puratronic™, 99.99% (metals basis)
CAS: 10377-52-3 Molecular Formula: Li3O4P Molecular Weight (g/mol): 115.79 MDL Number: MFCD00016187 InChI Key: TWQULNDIKKJZPH-UHFFFAOYSA-K Synonym: lithium phosphate,lithium orthophosphate,trilithium orthophosphate,trilithium phosphate,phosphoric acid, trilithium salt,unii-2qm4k05q74,lithiumphosphate,trilithotab phosphate,phosphoric acid, lithium salt 1:3,li3po4 PubChem CID: 165867 SMILES: [Li+].[Li+].[Li+].[O-]P([O-])([O-])=O
| PubChem CID | 165867 |
|---|---|
| CAS | 10377-52-3 |
| Molecular Weight (g/mol) | 115.79 |
| MDL Number | MFCD00016187 |
| SMILES | [Li+].[Li+].[Li+].[O-]P([O-])([O-])=O |
| Synonym | lithium phosphate,lithium orthophosphate,trilithium orthophosphate,trilithium phosphate,phosphoric acid, trilithium salt,unii-2qm4k05q74,lithiumphosphate,trilithotab phosphate,phosphoric acid, lithium salt 1:3,li3po4 |
| InChI Key | TWQULNDIKKJZPH-UHFFFAOYSA-K |
| Molecular Formula | Li3O4P |